DI-TERT-BUTYL ACETYLENEDICARBOXYLATE structure
|
Common Name | DI-TERT-BUTYL ACETYLENEDICARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 66086-33-7 | Molecular Weight | 226.26900 | |
| Density | 1.042g/cm3 | Boiling Point | 80-82ºC0.05 mm Hg(lit.) | |
| Molecular Formula | C12H18O4 | Melting Point | 33-37ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | ditert-butyl but-2-ynedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 80-82ºC0.05 mm Hg(lit.) |
| Melting Point | 33-37ºC(lit.) |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.26900 |
| Flash Point | >230 °F |
| Exact Mass | 226.12100 |
| PSA | 52.60000 |
| LogP | 1.67320 |
| Index of Refraction | 1.457 |
| InChIKey | FBCRUXRGQFLOMC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C#CC(=O)OC(C)(C)C |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | 34-36/37 |
| Safety Phrases | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 3 |
| Packaging Group | III |
| HS Code | 2917190090 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
A new method of anomeric protection and activation based on the conversion of glycosyl azides into glycosyl fluorides.
Carbohydr. Res. 249(1) , 221-41, (1993) Glycosyl azides provide reliable anomeric protection stable to conditions for hydrolytic removal of ester groups, for reductive opening or release of acetalic diol protection, for the introduction of ... |
|
|
Highly chemo-, regio-, and enantioselective rhodium-catalyzed cross-cyclotrimerization of two different alkynes with alkenes.
Angew. Chem. Int. Ed. Engl. 53(11) , 2956-9, (2014) It has been established that a cationic rhodium(I)/(R)-tol-binap complex catalyzes the cross-cyclotrimerization of silylacetylenes, di-tert-butyl acetylenedicarboxylates, and acrylamides with excellen... |
| di-tert-Butyl acetylenedicarboxylate |
| Di-tert-butyl 2-butynedioate |
| EINECS 266-135-4 |
| 2-Butynedioic acid di-tert-butyl ester |
| acetylenedicarboxylic acid di-tert-butyl ester |
| dietertiarybutyl acetylenedicarboxylate |
| MFCD00008808 |