N-BOC-1,6-hexanediamine hydrochloride structure
|
Common Name | N-BOC-1,6-hexanediamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 65915-94-8 | Molecular Weight | 252.781 | |
| Density | N/A | Boiling Point | 325.3ºC at 760 mmHg | |
| Molecular Formula | C11H25ClN2O2 | Melting Point | 162-164 °C(lit.) | |
| MSDS | USA | Flash Point | 150.5ºC | |
| Name | n-boc-1,6-diamino-hexane hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 325.3ºC at 760 mmHg |
|---|---|
| Melting Point | 162-164 °C(lit.) |
| Molecular Formula | C11H25ClN2O2 |
| Molecular Weight | 252.781 |
| Flash Point | 150.5ºC |
| Exact Mass | 252.160461 |
| PSA | 64.35000 |
| LogP | 3.92340 |
| InChIKey | JSBWQIZQJOQPFN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCN.Cl |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924199090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid, N-(6-aminohexyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1) |
| tert-Butyl (6-aminohexyl)carbamate hydrochloride (1:1) |
| 2-Methyl-2-propanyl (6-aminohexyl)carbamate hydrochloride (1:1) |
| tert-butyl N-(6-aminohexyl)carbamate,hydrochloride |
| EINECS 265-976-4 |
| MFCD00039072 |
| N-BOC-1,6-hexanediamine hydrochloride |