cyclopentyl-(3,4-dihydroxynaphthalen-2-yl)methanone
Modify Date: 2025-09-21 16:59:41
cyclopentyl-(3,4-dihydroxynaphthalen-2-yl)methanone structure
|
Common Name | cyclopentyl-(3,4-dihydroxynaphthalen-2-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 65363-46-4 | Molecular Weight | 256.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclopentyl-(3,4-dihydroxynaphthalen-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16O3 |
|---|---|
| Molecular Weight | 256.29600 |
| Exact Mass | 256.11000 |
| PSA | 57.53000 |
| LogP | 3.62390 |
| InChIKey | HOCPTTYTZGWRLQ-UHFFFAOYSA-N |
| SMILES | O=C(c1cc2ccccc2c(O)c1O)C1CCCC1 |
|
~%
cyclopentyl-(3,... CAS#:65363-46-4 |
| Literature: Takuwa,A. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 2973 - 2981 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methanone,cyclopentyl(3,4-dihydroxy-2-naphthalenyl) |