Pigment Red 13
Modify Date: 2025-08-25 17:13:31
Pigment Red 13 structure
|
Common Name | Pigment Red 13 | ||
|---|---|---|---|---|
| CAS Number | 6535-47-3 | Molecular Weight | 440.45100 | |
| Density | 1.32 | Boiling Point | 621.6ºC at 760 mmHg | |
| Molecular Formula | C25H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.7ºC | |
| Name | Pigment Red 13 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 |
|---|---|
| Boiling Point | 621.6ºC at 760 mmHg |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.45100 |
| Flash Point | 329.7ºC |
| Exact Mass | 440.14800 |
| PSA | 119.87000 |
| LogP | 7.33430 |
| Index of Refraction | 1.666 |
| InChIKey | ZULWYEUQOYBFOW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=Nc2c(O)c(C(=O)Nc3ccccc3C)cc3ccccc23)c([N+](=O)[O-])c1 |
| Hazard Codes | Xn,Xi |
|---|---|
| Risk Phrases | R22:Harmful if swallowed. R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| RIDADR | 2811 |
| RTECS | AF9900000 |
| Packaging Group | III |
| Einecs 229-441-9 |
| Toluidine moroon |
| Toluidine Maroon |
| Pigment Toluidine Maroon |
| 3172Pigment Red |
| Red 13 |