Pigment Red 81
Modify Date: 2025-08-20 15:16:18
Pigment Red 81 structure
|
Common Name | Pigment Red 81 | ||
|---|---|---|---|---|
| CAS Number | 12224-98-5 | Molecular Weight | 2261.00000 | |
| Density | 1.6-1.8 | Boiling Point | N/A | |
| Molecular Formula | C112H124MoN8O23PW | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Pigment Red 81 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6-1.8 |
|---|---|
| Molecular Formula | C112H124MoN8O23PW |
| Molecular Weight | 2261.00000 |
| Exact Mass | 2261.71000 |
| PSA | 459.86000 |
| LogP | 29.00400 |
| InChIKey | IWWWBRIIGAXLCJ-UHFFFAOYSA-O |
| SMILES | CCNc1cc2oc3cc(=[NH+]CC)c(C)cc-3c(-c3ccccc3C(=O)OCC)c2cc1C |
| Hazard Codes | Xi,Xn |
|---|---|
| Risk Phrases | R36/38:Irritating to eyes and skin . R36:Irritating to the eyes. R22:Harmful if swallowed. |
| Safety Phrases | S26-S36/37-S24/25 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | RO2850000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 3204170000 |
| HS Code | 3204170000 |
|---|
| MFCD00281165 |
| Fast Rose 44 |
| Fast Pink Toner |
| Toner Pink G |
| Fast Rose 40 |
| FANALPINKBSUPRA |
| Fanatone Rose G |
| Fanal Pink lake 6g |
| FANALPINKGSUPRA |
| EINECS 235-424-7 |