3-(1,2,3,6-tetrahydropyridin-4-yl)-1h-indole structure
|
Common Name | 3-(1,2,3,6-tetrahydropyridin-4-yl)-1h-indole | ||
|---|---|---|---|---|
| CAS Number | 65347-55-9 | Molecular Weight | 198.26400 | |
| Density | 1.163 g/cm3 | Boiling Point | 400.4ºC at 760 mmHg | |
| Molecular Formula | C13H14N2 | Melting Point | 177-182ºC | |
| MSDS | N/A | Flash Point | 195.9ºC | |
| Name | 3-(1,2,3,6-tetrahydropyridin-4-yl)-1h-indole |
|---|
| Density | 1.163 g/cm3 |
|---|---|
| Boiling Point | 400.4ºC at 760 mmHg |
| Melting Point | 177-182ºC |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.26400 |
| Flash Point | 195.9ºC |
| Exact Mass | 198.11600 |
| PSA | 27.82000 |
| LogP | 2.87340 |
| Index of Refraction | 1.691 |
| InChIKey | CIRSPTXGPFAXRE-UHFFFAOYSA-N |
| SMILES | C1=C(c2c[nH]c3ccccc23)CCNC1 |
| Hazard Codes | Xi: Irritant; |
|---|
|
~91%
3-(1,2,3,6-tetr... CAS#:65347-55-9 |
| Literature: US2006/122206 A1, ; Page/Page column 3 ; US 20060122206 A1 |
|
~70%
3-(1,2,3,6-tetr... CAS#:65347-55-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 22, # 7 p. 2560 - 2564 |
|
~%
3-(1,2,3,6-tetr... CAS#:65347-55-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 12, # 3 p. 307 - 310 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |