Ethacrynic acid sodium structure
|
Common Name | Ethacrynic acid sodium | ||
|---|---|---|---|---|
| CAS Number | 6500-81-8 | Molecular Weight | 325.12 | |
| Density | N/A | Boiling Point | 480ºC at 760 mmHg | |
| Molecular Formula | C13H11Cl2NaO4 | Melting Point | 121-122ºC | |
| MSDS | N/A | Flash Point | 244.1ºC | |
Use of Ethacrynic acid sodiumEthacrynic acid (Etacrynic acid sodium) sodium is a diuretic. Ethacrynic acid sodium is an inhibitor of glutathione S-transferases (GSTs). Ethacrynic acid sodium is a potent inhibitor of NF-kB-signaling pathway, and also modulates leukotriene formation. Ethacrynic acid sodium also inhibits L-type voltage-dependent and store-operated calcium channel, leading to relaxation of airway smooth muscle (ASM) cells. Ethacrynic acid sodium has anti-inflammatory properties that reduces the retinoid-induced ear edema in mice[1][2][3][4]. |
| Name | sodium,2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Ethacrynic acid (Etacrynic acid sodium) sodium is a diuretic. Ethacrynic acid sodium is an inhibitor of glutathione S-transferases (GSTs). Ethacrynic acid sodium is a potent inhibitor of NF-kB-signaling pathway, and also modulates leukotriene formation. Ethacrynic acid sodium also inhibits L-type voltage-dependent and store-operated calcium channel, leading to relaxation of airway smooth muscle (ASM) cells. Ethacrynic acid sodium has anti-inflammatory properties that reduces the retinoid-induced ear edema in mice[1][2][3][4]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 480ºC at 760 mmHg |
|---|---|
| Melting Point | 121-122ºC |
| Molecular Formula | C13H11Cl2NaO4 |
| Molecular Weight | 325.12 |
| Flash Point | 244.1ºC |
| Exact Mass | 323.99300 |
| PSA | 66.43000 |
| LogP | 2.27100 |
| InChIKey | CWCSCNSKBSCYCS-UHFFFAOYSA-M |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)[O-])c(Cl)c1Cl.[Na+] |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|
| UNII-K41MYV7MPM |
| Edecrin Sodium |
| Acetic acid,(2,3-dichloro-4-(2-methylene-1-oxobutyl)phenoxy)-,sodium salt |
| ETHACRYNATE SODIUM |
| Ethacrynate sodium (USP) |
| Sodium ethacrynate |
| Ethacrynic acid sodium |
| Sodium edecrin |