Tributyl[(Z)-2-ethoxyvinyl]stannane structure
|
Common Name | Tributyl[(Z)-2-ethoxyvinyl]stannane | ||
|---|---|---|---|---|
| CAS Number | 64724-29-4 | Molecular Weight | 361.151 | |
| Density | 1.082 | Boiling Point | 345.0±44.0 °C at 760 mmHg | |
| Molecular Formula | C16H34OSn | Melting Point | 84-87℃ | |
| MSDS | Chinese USA | Flash Point | 162.4±28.4 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | (Z)-1-Ethoxy-2-(tributylstannyl)ethene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082 |
|---|---|
| Boiling Point | 345.0±44.0 °C at 760 mmHg |
| Melting Point | 84-87℃ |
| Molecular Formula | C16H34OSn |
| Molecular Weight | 361.151 |
| Flash Point | 162.4±28.4 °C |
| Exact Mass | 362.163177 |
| PSA | 9.23000 |
| LogP | 9.34 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | n20/D1.479 |
| InChIKey | WARKYKQCOXTIAO-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](C=COCC)(CCCC)CCCC |
| Storage condition | 2-8°C |
| Water Solubility | Soluble in water. |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H319-H372-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P314-P501 |
| Hazard Codes | T,N |
| Risk Phrases | 21-25-36/38-48/23/25-50/53 |
| Safety Phrases | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1 / PGIII |
| HS Code | 2931900090 |
|
~%
Tributyl[(Z)-2-... CAS#:64724-29-4 |
| Literature: US2004/122018 A1, ; Page 156 ; |
|
~%
Tributyl[(Z)-2-... CAS#:64724-29-4 |
| Literature: WO2007/24593 A1, ; Page/Page column 50 ; WO 2007/024593 A1 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Stannane, tributyl[(Z)-2-ethoxyethenyl]- |
| z-(1)-ethoxy-(2)-(tributylstannyl)ethylen |
| Tributyl[(Z)-2-ethoxyvinyl]stannane |