6-methyluracil-5-sulfonyl chloride
Modify Date: 2025-08-25 20:09:41
6-methyluracil-5-sulfonyl chloride structure
|
Common Name | 6-methyluracil-5-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 6461-30-9 | Molecular Weight | 224.62200 | |
| Density | 1.76g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H5ClN2O4S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 6-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Molecular Formula | C5H5ClN2O4S |
| Molecular Weight | 224.62200 |
| Exact Mass | 223.96600 |
| PSA | 108.24000 |
| LogP | 0.37990 |
| Index of Refraction | 1.603 |
| InChIKey | XDXYTKIQVSJRIX-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1S(=O)(=O)Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~82%
6-methyluracil-... CAS#:6461-30-9 |
| Literature: Pogorelova; Orlov; Isak Russian Journal of Applied Chemistry, 2006 , vol. 79, # 4 p. 631 - 633 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methyluracil-5-sulfonyl chloride |
| 1,2,3,4-tetrahydro-6-methyl-2,4-dioxo-5-pyrimidinesulfonyl chloride |
| 6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl chloride |
| 6-methyluracil-5-sulfochloride |
| 6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidinyl-5-sulfochloride |
| 6-Methyluracil-5-sulfonyl Chlorid |