AGL-2263 structure
|
Common Name | AGL-2263 | ||
|---|---|---|---|---|
| CAS Number | 638213-98-6 | Molecular Weight | 322.272 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AGL-2263AGL-2263 is an insulin receptor (IR) blocker. |
| Name | AGL-2263 |
|---|---|
| Synonym | More Synonyms |
| Description | AGL-2263 is an insulin receptor (IR) blocker. |
|---|---|
| Related Catalog | |
| Target |
Insulin receptor[1]. |
| In Vitro | AGL-2263 is an insulin receptor (IR) blocker[1]. |
| Cell Assay | Trophoblast cells are prepared from normal or GDM placentas. They are incubated in the presence of stimulants, insulin (100 nM) or both insulin and AGL-2263 (AGL, 5 μM) IR blocker, together for 24 hr[1]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H10N2O5 |
| Molecular Weight | 322.272 |
| Exact Mass | 322.058960 |
| LogP | 1.72 |
| Index of Refraction | 1.728 |
| InChIKey | IUGRBTCJEYEDIY-VZUCSPMQSA-N |
| SMILES | N#CC(=Cc1ccc2oc(=O)[nH]c2c1)C(=O)c1ccc(O)c(O)c1 |
| Storage condition | 2-8℃ |
| (2E)-2-(3,4-Dihydroxybenzoyl)-3-(2-oxo-2,3-dihydro-1,3-benzoxazol-5-yl)acrylonitrile |
| Benzenepropanenitrile, α-[(2,3-dihydro-2-oxo-5-benzoxazolyl)methylene]-3,4-dihydroxy-β-oxo-, (αE)- |