METHYL 4-(1,1''-BIPHENYL-4-YL)-2,4-DIOXOBUTANOATE structure
|
Common Name | METHYL 4-(1,1''-BIPHENYL-4-YL)-2,4-DIOXOBUTANOATE | ||
|---|---|---|---|---|
| CAS Number | 63656-27-9 | Molecular Weight | 282.29100 | |
| Density | 1.194g/cm3 | Boiling Point | 450.194ºC at 760 mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.407ºC | |
| Name | methyl 2,4-dioxo-4-(4-phenylphenyl)butanoate |
|---|
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 450.194ºC at 760 mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 200.407ºC |
| Exact Mass | 282.08900 |
| PSA | 60.44000 |
| LogP | 2.66850 |
| Index of Refraction | 1.561 |
| InChIKey | YDYQRPUOLGQGFI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |