CCA structure
|
Common Name | CCA | ||
|---|---|---|---|---|
| CAS Number | 63329-53-3 | Molecular Weight | 291.686 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 481.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H10ClNO4 | Melting Point | 64-66 °C(lit.) | |
| MSDS | N/A | Flash Point | 244.7±28.7 °C | |
Use of CCALobenzarit, an immunomodulator, possesses anti-oxidative[1]. |
| Name | Lobenzarit |
|---|---|
| Synonym | More Synonyms |
| Description | Lobenzarit, an immunomodulator, possesses anti-oxidative[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 481.0±45.0 °C at 760 mmHg |
| Melting Point | 64-66 °C(lit.) |
| Molecular Formula | C14H10ClNO4 |
| Molecular Weight | 291.686 |
| Flash Point | 244.7±28.7 °C |
| Exact Mass | 291.029846 |
| PSA | 86.63000 |
| LogP | 6.91 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.700 |
| InChIKey | UGDPYGKWIHHBMB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1cc(Cl)ccc1C(=O)O |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34:Causes burns. |
| Safety Phrases | S26-S27-S28-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
|
~%
Detail
|
| Literature: US4092426 A1, ; |
|
~%
CCA CAS#:63329-53-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 26, # 11 p. 1619 - 1625 |
| CCA |
| 4-Chloro-2,2'-iminodibenzoic acid |
| N-(2-carboxyphenyl)-4-chloranthranilic acid disodium |
| 2-(2-carboxyphenylamino)-4-chlorobenzoic acid |
| MFCD00941422 |
| Benzoic acid, 2-[(2-carboxyphenyl)amino]-4-chloro- |
| 5-chloro-2'-carboxydiphenylamine-2-carboxylic acid |
| N-(2-carboxyphenylamino)-4-chlorobenzoic acid |
| 4-Chloro-2-(2-carboxyphenylamino)benzoic acid |
| 2-[(2-Carboxyphenyl)amino]-4-chlorobenzoic acid |
| N-2'-carboxyphenyl-4-chloroanthranilic acid |
| Carfenil |