bis(ethylsulfonyl)methylcyclohexane
Modify Date: 2025-08-20 21:30:01
bis(ethylsulfonyl)methylcyclohexane structure
|
Common Name | bis(ethylsulfonyl)methylcyclohexane | ||
|---|---|---|---|---|
| CAS Number | 6331-26-6 | Molecular Weight | 282.42000 | |
| Density | 1.208g/cm3 | Boiling Point | 503.4ºC at 760 mmHg | |
| Molecular Formula | C11H22O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.6ºC | |
| Name | [methyl(propyl)silanediyl]dimethanediyl diacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 503.4ºC at 760 mmHg |
| Molecular Formula | C11H22O4S2 |
| Molecular Weight | 282.42000 |
| Flash Point | 325.6ºC |
| Exact Mass | 282.09600 |
| PSA | 85.04000 |
| LogP | 3.92380 |
| Index of Refraction | 1.498 |
| InChIKey | DFXMBVYGMKUBCT-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C(C1CCCCC1)S(=O)(=O)CC |
|
~%
bis(ethylsulfon... CAS#:6331-26-6 |
| Literature: Cronyn Journal of the American Chemical Society, 1952 , vol. 74, p. 1225,1230 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (bis-ethanesulfonyl-methyl)-cyclohexane |
| 2-methyl-1,3-diacetoxy-2-propyl-2-silapropane |
| (Bis-aethansulfonyl-methyl)-cyclohexan |
| (Bis-acetoxymethyl)-methyl-propylsilan |