bis(ethylsulfonyl)methylbenzene
Modify Date: 2025-09-11 08:58:05
bis(ethylsulfonyl)methylbenzene structure
|
Common Name | bis(ethylsulfonyl)methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 32341-86-9 | Molecular Weight | 276.37200 | |
| Density | 1.287g/cm3 | Boiling Point | 531.3ºC at 760 mmHg | |
| Molecular Formula | C11H16O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 356.8ºC | |
| Name | bis(ethylsulfonyl)methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Boiling Point | 531.3ºC at 760 mmHg |
| Molecular Formula | C11H16O4S2 |
| Molecular Weight | 276.37200 |
| Flash Point | 356.8ºC |
| Exact Mass | 276.04900 |
| PSA | 85.04000 |
| LogP | 3.71620 |
| Index of Refraction | 1.541 |
| InChIKey | WRQJZQFWYRJUSU-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C(c1ccccc1)S(=O)(=O)CC |
| HS Code | 2904100000 |
|---|
|
~50%
bis(ethylsulfon... CAS#:32341-86-9 |
| Literature: Aiken, Fiona; Cox, Brian G.; Soerensen, Poul E. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1993 , # 4 p. 783 - 790 |
|
~%
bis(ethylsulfon... CAS#:32341-86-9 |
| Literature: Aiken, Fiona; Cox, Brian G.; Soerensen, Poul E. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1993 , # 4 p. 783 - 790 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| phenyl[bis(ethylsulfonyl)]methane |
| [bis(ethylsulfonyl)methyl]benzene |
| Benzyliden-bis-aethylsulfon |
| Benzal-bis-aethylsulfon |
| Bis-aethansulfonyl-phenyl-methan |
| bis-ethanesulfonyl-phenyl-methane |