Nuarimol structure
|
Common Name | Nuarimol | ||
|---|---|---|---|---|
| CAS Number | 63284-71-9 | Molecular Weight | 314.741 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 475.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H12ClFN2O | Melting Point | 126°C | |
| MSDS | Chinese USA | Flash Point | 241.2±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | nuarimol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 475.2±40.0 °C at 760 mmHg |
| Melting Point | 126°C |
| Molecular Formula | C17H12ClFN2O |
| Molecular Weight | 314.741 |
| Flash Point | 241.2±27.3 °C |
| Exact Mass | 314.062225 |
| PSA | 46.01000 |
| LogP | 2.68 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | SAPGTCDSBGMXCD-UHFFFAOYSA-N |
| SMILES | OC(c1ccc(F)cc1)(c1cncnc1)c1ccccc1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Enantioselective separation and simultaneous determination of fenarimol and nuarimol in fruits, vegetables, and soil by liquid chromatography-tandem mass spectrometry.
Anal. Bioanal. Chem 404(6-7) , 1983-91, (2012) A method for simultaneous enantioselective determination of fenarimol and nuarimol in apple, grape, cucumber, tomato, and soil was developed using liquid chromatography-tandem mass spectrometry. The e... |
|
|
Pesticide analysis in tomatoes by solid-phase microextraction and micellar electrokinetic chromatography.
J. Chromatogr. A. 1185(1) , 151-4, (2008) The analysis of a group of seven pesticides (i.e. six fungicides: pyrimethanil, procymidone, nuarimol, fenarimol, benalaxyl and penconazole and one insecticide: pirimicarb) in tomato samples by micell... |
|
|
[The effect of nuarimol on the mutagenic activity of n-nitrosodimethylamine and 2-acetylaminofluorene in mouse erythrocytes].
Rocz. Panstw. Zakl. Hig. 49(1) , 55-66, (1998) Nuarimol, the structural analogue of DDT, similarly to other polychlorinated aromatic hydrocarbons, induces monoxygenase activity. N-nitrosodimethylamine (NDMA) and 2-acetylaminofluorene (2-AAF) belon... |
| Gauntlet |
| UNII:ZU7K80U0CY |
| murox |
| Caswell No. 419G |
| trimifruitsc |
| triminol |
| el2289 |
| Trimiol |
| Nuarimol |
| α-(2-Chlorophenyl)-α-(4-fluorophenyl)-5-pyrimidinemethanol |
| (2-chlorophenyl)(4-fluorophenyl)pyrimidin-5-ylmethanol |
| el228 |
| (2-Chlorphenyl)(4-fluorphenyl)pyrimidin-5-ylmethanol |
| (RS)-2-chloro-4’-fluoro-α-(pyrimidin-5-yl)benzhydryl alcohol |
| (2-Chlorophenyl)(4-fluorophenyl)5-pyrimidinylmethanol |
| a-(2-Chlorophenyl)-a-(4-fluorophenyl)-5-pyrimidinemethanol |
| MFCD00078677 |
| (RS)-2-Chloro-4'-fluoro-a-(pyrimidin-5-yl)benzhydryl alcohol |
| rac-(R)-(2-chlorophenyl)(4-fluorophenyl)(pyrimidin-5-yl)methanol |
| (±)-Nuarimol |
| TRIMIDAL |
| guantlet |
| EINECS 264-071-1 |
| 5-Pyrimidinemethanol, α-(2-chlorophenyl)-α-(4-fluorophenyl)- |