3-methyl-1-pyridin-1-yl-butan-2-one structure
|
Common Name | 3-methyl-1-pyridin-1-yl-butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 6322-27-6 | Molecular Weight | 291.12900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1-pyridin-1-ium-1-ylbutan-2-one,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14INO |
|---|---|
| Molecular Weight | 291.12900 |
| Exact Mass | 291.01200 |
| PSA | 20.95000 |
| InChIKey | NILSXYAWQIWKMA-UHFFFAOYSA-M |
| SMILES | CC(C)C(=O)C[n+]1ccccc1.[I-] |
|
~41%
3-methyl-1-pyri... CAS#:6322-27-6 |
| Literature: Lodha; Saxena Journal of the Indian Chemical Society, 1991 , vol. 68, # 2 p. 99 - 100 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-methyl-1-pyridin-1-ium-1-ylbutan-2-one |