4-dimethylamino-3-oxo-2-phenyl-butanenitrile
Modify Date: 2025-08-25 10:51:57
4-dimethylamino-3-oxo-2-phenyl-butanenitrile structure
|
Common Name | 4-dimethylamino-3-oxo-2-phenyl-butanenitrile | ||
|---|---|---|---|---|
| CAS Number | 6309-83-7 | Molecular Weight | 202.25200 | |
| Density | 1.082g/cm3 | Boiling Point | 280.4ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.4ºC | |
| Name | 4-(dimethylamino)-3-oxo-2-phenylbutanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082g/cm3 |
|---|---|
| Boiling Point | 280.4ºC at 760 mmHg |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.25200 |
| Flash Point | 123.4ºC |
| Exact Mass | 202.11100 |
| PSA | 44.10000 |
| LogP | 1.42448 |
| Index of Refraction | 1.533 |
| InChIKey | YIBKYVIFYWTSLQ-UHFFFAOYSA-N |
| SMILES | CN(C)CC(=O)C(C#N)c1ccccc1 |
| HS Code | 2926909090 |
|---|
|
~%
4-dimethylamino... CAS#:6309-83-7 |
| Literature: Russell; Hitchings Journal of the American Chemical Society, 1951 , vol. 73, p. 3763,3766 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-dimethylamino-2-phenyl-acetoacetonitrile |
| 4-DIMETHYLAMINO-3-OXO-2-PHENYL-BUTANENITRILE |