4-dimethylamino-2-ethyl-2-phenyl-butanenitrile
Modify Date: 2025-09-19 10:12:52
4-dimethylamino-2-ethyl-2-phenyl-butanenitrile structure
|
Common Name | 4-dimethylamino-2-ethyl-2-phenyl-butanenitrile | ||
|---|---|---|---|---|
| CAS Number | 2809-44-1 | Molecular Weight | 216.32200 | |
| Density | 0.97g/cm3 | Boiling Point | 325ºC at 760mmHg | |
| Molecular Formula | C14H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9ºC | |
| Name | 4-(dimethylamino)-2-ethyl-2-phenylbutanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 325ºC at 760mmHg |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.32200 |
| Flash Point | 129.9ºC |
| Exact Mass | 216.16300 |
| PSA | 27.03000 |
| LogP | 2.80968 |
| Vapour Pressure | 0.000237mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | FUTYMWBLUNRHIR-UHFFFAOYSA-N |
| SMILES | CCC(C#N)(CCN(C)C)c1ccccc1 |
|
~%
4-dimethylamino... CAS#:2809-44-1 |
| Literature: Tutwiler et al. Journal of Organic Chemistry, 1954 , vol. 19, p. 910,911, 915 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Aethyl-4-dimethylamino-2-phenyl-butyronitril |
| BUTYRONITRILE,4-(DIMETHYLAMINO)-2-ETHYL-2-PHENYL |
| 4-(Dimethylamino)-2-ethyl-2-phenylbutyronitrile |
| 2-ethyl-4-dimethylamino-2-phenyl-butyronitrile |