benzquinamide
Modify Date: 2025-08-25 13:35:30
benzquinamide structure
|
Common Name | benzquinamide | ||
|---|---|---|---|---|
| CAS Number | 63-12-7 | Molecular Weight | 404.50000 | |
| Density | 1.2±0.1g/cm3 | Boiling Point | 531.0±50.0°C at 760 mmHg | |
| Molecular Formula | C22H32N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.9±30.1°C | |
Use of benzquinamideBenzquinamide is an antiemetic which can bind to the α2A, α2B, and α2C adrenergic receptors (α2-AR) with Ki values of 1,365, 691, and 545 nM, respectively. |
| Name | benzquinamide |
|---|---|
| Synonym | More Synonyms |
| Description | Benzquinamide is an antiemetic which can bind to the α2A, α2B, and α2C adrenergic receptors (α2-AR) with Ki values of 1,365, 691, and 545 nM, respectively. |
|---|---|
| Related Catalog | |
| Target |
Ki: 1,365 nM (α2A), 691 nM (α2B), 545 nM (α2C)[1]. |
| References |
| Density | 1.2±0.1g/cm3 |
|---|---|
| Boiling Point | 531.0±50.0°C at 760 mmHg |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.50000 |
| Flash Point | 274.9±30.1°C |
| Exact Mass | 404.23100 |
| PSA | 68.31000 |
| LogP | 2.36090 |
| InChIKey | JSZILQVIPPROJI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1CN2CCc3cc(OC)c(OC)cc3C2CC1OC(C)=O |
| P2647 |