4-(3-chloro-4-fluorophenyl)-4-oxobutanoic acid structure
|
Common Name | 4-(3-chloro-4-fluorophenyl)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 62903-16-6 | Molecular Weight | 230.62000 | |
| Density | 1.399g/cm3 | Boiling Point | 419.9ºC at 760 mmHg | |
| Molecular Formula | C10H8ClFO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.8ºC | |
| Name | 4-(3-chloro-4-fluorophenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 419.9ºC at 760 mmHg |
| Molecular Formula | C10H8ClFO3 |
| Molecular Weight | 230.62000 |
| Flash Point | 207.8ºC |
| Exact Mass | 230.01500 |
| PSA | 54.37000 |
| LogP | 2.52660 |
| Index of Refraction | 1.543 |
| InChIKey | HEGKPWCFQKZTBW-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc(F)c(Cl)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
|
~%
4-(3-chloro-4-f... CAS#:62903-16-6 |
| Literature: Hicks; Smith; Williamson; Day Journal of Medicinal Chemistry, 1979 , vol. 22, # 12 p. 1460 - 1464 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(3-Chloro-4-fluorophenyl)-4-oxobutyric acid |
| PC5285 |
| 3-(3-Chlor-4-fluorbenzoyl)propionsaeure |