Bucloxic acid
Modify Date: 2025-09-14 18:24:26
Bucloxic acid structure
|
Common Name | Bucloxic acid | ||
|---|---|---|---|---|
| CAS Number | 32808-51-8 | Molecular Weight | 294.77300 | |
| Density | 1.219g/cm3 | Boiling Point | 482ºC at 760mmHg | |
| Molecular Formula | C16H19ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.3ºC | |
Use of Bucloxic acidBucloxic acid is an anti-inflammatory pyrrazole derivative. Bucloxic acid can be used in the treatment of chronic glomerular nephropathies. |
| Name | 4-(3-Chloro-4-cyclohexylphenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Bucloxic acid is an anti-inflammatory pyrrazole derivative. Bucloxic acid can be used in the treatment of chronic glomerular nephropathies. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 482ºC at 760mmHg |
| Molecular Formula | C16H19ClO3 |
| Molecular Weight | 294.77300 |
| Flash Point | 245.3ºC |
| Exact Mass | 294.10200 |
| PSA | 54.37000 |
| LogP | 4.43520 |
| Index of Refraction | 1.557 |
| InChIKey | IJTPQQVCKPZIMV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc(C2CCCCC2)c(Cl)c1 |
| Storage condition | 2-8℃ |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Acide bucloxique [INN-French] |
| Bucloxinsaeure [German] |
| l'Acide bucloxique [French] |
| 4-(3-Chloro-4-cyclohexylphenyl)-4-oxo-buttersaeure |
| Bucloxonic acid |
| Acidum bucloxicum [INN-Latin] |
| Esfar |
| EINECS 251-231-0 |
| 4-(3-chloro-4-cyclohexylphenyl)-4-oxobutyric acid |
| Acido bucloxico [INN-Spanish] |
| Bucloxic Acid |
| 3-(3-chloro-4-cyclohexylbenzoyl)propionic acid |
| Bucloxinsaeure |