1-carbamoylethyl 2-ethylhexanoate
Modify Date: 2025-09-23 19:18:35
1-carbamoylethyl 2-ethylhexanoate structure
|
Common Name | 1-carbamoylethyl 2-ethylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 6288-15-9 | Molecular Weight | 215.28900 | |
| Density | 1g/cm3 | Boiling Point | 334.8ºC at 760 mmHg | |
| Molecular Formula | C11H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.2ºC | |
| Name | (1-amino-1-oxopropan-2-yl) 2-ethylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 334.8ºC at 760 mmHg |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.28900 |
| Flash Point | 132.2ºC |
| Exact Mass | 215.15200 |
| PSA | 69.39000 |
| LogP | 2.32010 |
| Index of Refraction | 1.454 |
| InChIKey | YTWHORWZTZTBSD-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OC(C)C(N)=O |
|
~%
1-carbamoylethy... CAS#:6288-15-9 |
| Literature: Fein; Filachione Journal of the American Chemical Society, 1953 , vol. 75, p. 2097 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(2-Aethyl-hexanoyloxy)-propionamid |
| 1-amino-1-oxopropan-2-yl 2-ethylhexanoate |
| 2-(2-Aethyl-hexanoyloxy)-propionsaeure-amid |
| 2-(2-ethyl-hexanoyloxy)-propionic acid amide |