1-[2-(2-ethylhexanoyloxy)propanoylamino]propan-2-yl 2-ethylhexanoate structure
|
Common Name | 1-[2-(2-ethylhexanoyloxy)propanoylamino]propan-2-yl 2-ethylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 6288-29-5 | Molecular Weight | 399.56500 | |
| Density | 0.983g/cm3 | Boiling Point | 516.7ºC at 760 mmHg | |
| Molecular Formula | C22H41NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.3ºC | |
| Name | 1-[2-(2-ethylhexanoyloxy)propanoylamino]propan-2-yl 2-ethylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.983g/cm3 |
|---|---|
| Boiling Point | 516.7ºC at 760 mmHg |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.56500 |
| Flash Point | 266.3ºC |
| Exact Mass | 399.29800 |
| PSA | 81.70000 |
| LogP | 4.78970 |
| Index of Refraction | 1.458 |
| InChIKey | BUFBUWAALXANIF-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OC(C)CNC(=O)C(C)OC(=O)C(CC)CCCC |
|
~%
1-[2-(2-ethylhe... CAS#:6288-29-5 |
| Literature: Fein; Filachione Journal of the American Chemical Society, 1953 , vol. 75, p. 2097 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2-Aethyl-hexanoyloxy)-propionsaeure-[2-(2-aethyl-hexanoyloxy)-propylamid] |
| 2-(2-ethyl-hexanoyloxy)-propionic acid-[2-(2-ethyl-hexanoyloxy)-propylamide] |
| 1-({2-[(2-ethylhexanoyl)oxy]propanoyl}amino)propan-2-yl 2-ethylhexanoate |