1-(dibutylcarbamoyl)ethyl 2-ethylhexanoate
Modify Date: 2025-11-26 20:16:08
1-(dibutylcarbamoyl)ethyl 2-ethylhexanoate structure
|
Common Name | 1-(dibutylcarbamoyl)ethyl 2-ethylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 6288-28-4 | Molecular Weight | 327.50200 | |
| Density | 0.933g/cm3 | Boiling Point | 416.8ºC at 760 mmHg | |
| Molecular Formula | C19H37NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | [1-(dibutylamino)-1-oxopropan-2-yl] 2-ethylhexanoate |
|---|
| Density | 0.933g/cm3 |
|---|---|
| Boiling Point | 416.8ºC at 760 mmHg |
| Molecular Formula | C19H37NO3 |
| Molecular Weight | 327.50200 |
| Flash Point | 205.9ºC |
| Exact Mass | 327.27700 |
| PSA | 46.61000 |
| LogP | 4.56330 |
| Index of Refraction | 1.456 |
| InChIKey | KMCZEAHLLDORIG-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OC(C)C(=O)N(CCCC)CCCC |
|
~%
1-(dibutylcarba... CAS#:6288-28-4 |
| Literature: Fein; Filachione Journal of the American Chemical Society, 1953 , vol. 75, p. 2097 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |