NSC10010 hydrochloride structure
|
Common Name | NSC10010 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 6286-09-5 | Molecular Weight | 537.13600 | |
| Density | 1.137g/cm3 | Boiling Point | 674.2ºC at 760 mmHg | |
| Molecular Formula | C31H41ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 361.5ºC | |
Use of NSC10010 hydrochlorideNSC10010 hydrochloride inhibits gammaherpesvirus associated B-lymphomas growth through activation of NF-kB and c-Myc-mediated signaling pathways. NSC10010 hydrochloride induces necrotic cell death in gammaherpesvirus infected B-cells. NSC10010 hydrochloride is also an inhibitor of Mtb ClpC1 ATPase[1][2]. |
| Name | N,N-Bis(2-methyl-6-methoxy-4-quinaldyl)-1,9-diamino- nonane Dihydrochloride Hydrate |
|---|
| Description | NSC10010 hydrochloride inhibits gammaherpesvirus associated B-lymphomas growth through activation of NF-kB and c-Myc-mediated signaling pathways. NSC10010 hydrochloride induces necrotic cell death in gammaherpesvirus infected B-cells. NSC10010 hydrochloride is also an inhibitor of Mtb ClpC1 ATPase[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 674.2ºC at 760 mmHg |
| Molecular Formula | C31H41ClN4O2 |
| Molecular Weight | 537.13600 |
| Flash Point | 361.5ºC |
| Exact Mass | 536.29200 |
| PSA | 68.30000 |
| LogP | 8.61970 |
| Index of Refraction | 1.632 |
| InChIKey | PYXMJTIQBGOWBI-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(C)cc(NCCCCCCCCCNc3cc(C)nc4ccc(OC)cc34)c2c1.Cl.Cl |