1-(4-Nitrophenyl)piperazine structure
|
Common Name | 1-(4-Nitrophenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 6269-89-2 | Molecular Weight | 207.229 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 391.9±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H13N3O2 | Melting Point | 131-133 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 190.8±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4-Nitrophenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 391.9±27.0 °C at 760 mmHg |
| Melting Point | 131-133 °C(lit.) |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.229 |
| Flash Point | 190.8±23.7 °C |
| Exact Mass | 207.100784 |
| PSA | 61.09000 |
| LogP | 1.56 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | VWOJSRICSKDKAW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCNCC2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2933599090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Investigation on the inclusion interaction of 4-sulfonatocalix[n]arenes with 1-(4-nitrophenyl)piperazine.
Spectrochim. Acta. A. Mol. Biomol. Spectrosc. 132C , 44-51, (2014) The inclusion behaviors of 4-Sulfonatocalix[n]arenes (SCXn) (n=4, 6, 8) with 1-(4-nitrophenyl)piperazine (NPP) were investigated by UV spectroscopy and fluorescence spectroscopy at different pH values... |
| 1-Nitro-4-piperazinobenzene |
| N-(P-NITROPHENYL) PIPERAZINE |
| Piperazine,1-(4-nitrophenyl) |
| 1-(4-NO2Ph)Pip |
| 1-(4-nitro-phenyl)-piperazine |
| RARECHEM AH CK 0146 |
| 4-nitro-1-(1-piperazinyl)benzene |
| 1-(4-Nitrophenyl)piperazine |
| 4-(4-nitrophenyl)piperazine |
| Piperazine, 1-(4-nitrophenyl)- |
| 1-(P-NITROPHENYL)PIPERAZINE |
| N-(4-nitrophenyl)-piperazine |
| EINECS 228-443-7 |
| MFCD00005961 |