4-(4-(Methylsulfonyl)piperazin-1-yl)aniline
4-(4-(Methylsulfonyl)piperazin-1-yl)aniline structure
|
Common Name | 4-(4-(Methylsulfonyl)piperazin-1-yl)aniline | ||
|---|---|---|---|---|
| CAS Number | 442549-42-0 | Molecular Weight | 255.337 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 475.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C11H17N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.5±31.5 °C | |
| Name | 4-(4-methylsulfonylpiperazin-1-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 475.7±55.0 °C at 760 mmHg |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.337 |
| Flash Point | 241.5±31.5 °C |
| Exact Mass | 255.104141 |
| PSA | 75.02000 |
| LogP | -0.25 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | DFLQDPGZILSRHW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(N)cc2)CC1 |
| HS Code | 2933599090 |
|---|
|
~87%
4-(4-(Methylsul... CAS#:442549-42-0 |
| Literature: WO2012/59932 A1, ; Page/Page column 118-119 ; WO 2012/059932 A1 |
|
~%
4-(4-(Methylsul... CAS#:442549-42-0 |
| Literature: US2004/87575 A1, ; US 20040087575 A1 |
|
~%
4-(4-(Methylsul... CAS#:442549-42-0 |
| Literature: WO2012/59932 A1, ; WO 2012/059932 A1 |
|
~%
4-(4-(Methylsul... CAS#:442549-42-0 |
| Literature: WO2012/59932 A1, ; WO 2012/059932 A1 |
|
~%
4-(4-(Methylsul... CAS#:442549-42-0 |
| Literature: WO2012/59932 A1, ; WO 2012/059932 A1 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[4-(methylsulfonyl)piperazin-1-yl]aniline |
| 4-[4-(Methylsulfonyl)-1-piperazinyl]aniline |
| Benzenamine, 4-[4-(methylsulfonyl)-1-piperazinyl]- |