6-methoxy-2-(4-methoxyphenyl)-1H-indole structure
|
Common Name | 6-methoxy-2-(4-methoxyphenyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 62655-56-5 | Molecular Weight | 253.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methoxy-2-(4-methoxyphenyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15NO2 |
|---|---|
| Molecular Weight | 253.29600 |
| Exact Mass | 253.11000 |
| PSA | 34.25000 |
| LogP | 3.85210 |
| InChIKey | IPLDCJXQHIIQEC-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc3ccc(OC)cc3[nH]2)cc1 |
|
~%
6-methoxy-2-(4-... CAS#:62655-56-5 |
| Literature: ELI LILLY AND COMPANY Patent: EP759441 A2, 1997 ; |
|
~73%
6-methoxy-2-(4-... CAS#:62655-56-5 |
| Literature: Vara, Yosu; Aldaba, Eneko; Arrieta, Ana; Pizarro, Jose L.; Arriortua, Maria I.; Cossio, Fernando P. Organic and Biomolecular Chemistry, 2008 , vol. 6, # 10 p. 1763 - 1772 |
|
~%
6-methoxy-2-(4-... CAS#:62655-56-5 |
| Literature: Angerer, Erwin von; Prekajac, Jelica; Strohmeier, Josef Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1439 - 1447 |
| 6-Methoxy-2-(4-methoxyphenyl)-indol |
| 6-methoxyphenylindole |
| 6-methoxy-2-(4-methoxyphenyl)indole |
| 2-(4'-methoxy-phenyl)-6-methoxy-indole |
| 1H-Indole,6-methoxy-2-(4-methoxyphenyl) |