Ro 106-9920
Modify Date: 2025-09-10 22:04:22
Ro 106-9920 structure
|
Common Name | Ro 106-9920 | ||
|---|---|---|---|---|
| CAS Number | 62645-28-7 | Molecular Weight | 245.260 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H7N5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ro 106-9920Ro 106-9920 is a potent inhibitor of NF-kappaB. Ro 106-9920 has the potential for the research of tumor and cancer diseases[1]. |
| Name | 6-(benzenesulfinyl)tetrazolo[1,5-b]pyridazine |
|---|---|
| Synonym | More Synonyms |
| Description | Ro 106-9920 is a potent inhibitor of NF-kappaB. Ro 106-9920 has the potential for the research of tumor and cancer diseases[1]. |
|---|---|
| Related Catalog | |
| Target |
NF-kappaB[1] |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H7N5OS |
| Molecular Weight | 245.260 |
| Exact Mass | 245.037125 |
| PSA | 92.25000 |
| LogP | -0.41 |
| Index of Refraction | 1.856 |
| InChIKey | JFSXSNSCPNFCDM-UHFFFAOYSA-N |
| SMILES | O=S(c1ccccc1)c1ccc2nnnn2n1 |
| Ro 106-9920 |
| 6-(Phenylsulfinyl)tetrazolo[1,5-b]pyridazine |
| 6-Phenylsulphinyl-tetrazolo<1.5-b>pyridazin |
| Tetrazolo[1,5-b]pyridazine, 6-(phenylsulfinyl)- |
| Tocris-1778 |