(2-cyano-1-phenylhexan-2-yl) ethaneperoxoate
Modify Date: 2024-01-10 21:47:25
(2-cyano-1-phenylhexan-2-yl) ethaneperoxoate structure
|
Common Name | (2-cyano-1-phenylhexan-2-yl) ethaneperoxoate | ||
|---|---|---|---|---|
| CAS Number | 62623-60-3 | Molecular Weight | 261.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-cyano-1-phenylhexan-2-yl) ethaneperoxoate |
|---|
| Molecular Formula | C15H19NO3 |
|---|---|
| Molecular Weight | 261.31600 |
| Exact Mass | 261.13600 |
| PSA | 59.32000 |
| LogP | 3.17638 |
| InChIKey | XYHBGRPZSVOJST-UHFFFAOYSA-N |
| SMILES | CCCCC(C#N)(Cc1ccccc1)OOC(C)=O |
|
~%
(2-cyano-1-phen... CAS#:62623-60-3 |
| Literature: Freerksen; Pabst; Raggio; Sherman; Wroble; Watt Journal of the American Chemical Society, 1977 , vol. 99, # 5 p. 1536 - 1542 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |