Peracetic acid 1-cyano-3-cyclohexyl-1-methylpropyl ester
Modify Date: 2025-10-06 20:25:26
Peracetic acid 1-cyano-3-cyclohexyl-1-methylpropyl ester structure
|
Common Name | Peracetic acid 1-cyano-3-cyclohexyl-1-methylpropyl ester | ||
|---|---|---|---|---|
| CAS Number | 58422-64-3 | Molecular Weight | 239.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-cyano-4-cyclohexylbutan-2-yl) ethaneperoxoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H21NO3 |
|---|---|
| Molecular Weight | 239.31100 |
| Exact Mass | 239.15200 |
| PSA | 59.32000 |
| LogP | 3.12388 |
| InChIKey | CLBTVOUGQOUGFT-UHFFFAOYSA-N |
| SMILES | CC(=O)OOC(C)(C#N)CCC1CCCCC1 |
|
~%
Peracetic acid ... CAS#:58422-64-3 |
| Literature: Freerksen; Pabst; Raggio; Sherman; Wroble; Watt Journal of the American Chemical Society, 1977 , vol. 99, # 5 p. 1536 - 1542 |
| 2-Peracetoxy-2-methyl-4-cyclohexylbutyronitril |
| Ethaneperoxoic acid,1-cyano-3-cyclohexyl-1-methylpropyl ester |