Benzoic acid, 3,5-dinitro-, sodium salt
Modify Date: 2025-10-17 08:13:38
Benzoic acid, 3,5-dinitro-, sodium salt structure
|
Common Name | Benzoic acid, 3,5-dinitro-, sodium salt | ||
|---|---|---|---|---|
| CAS Number | 6226-55-7 | Molecular Weight | 394.87200 | |
| Density | 1.315g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H19ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]-N-prop-2-enylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315g/cm3 |
|---|---|
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.87200 |
| Exact Mass | 394.07500 |
| PSA | 87.58000 |
| LogP | 4.76720 |
| Index of Refraction | 1.595 |
| InChIKey | ZXEBYRNQCFHRTN-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)CN(c1ccc(OC)c(Cl)c1)S(=O)(=O)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
Benzoic acid, 3... CAS#:6226-55-7 |
| Literature: Zhang, Jing; Zhu, Long-Guan Synthesis and Reactivity in Inorganic, Metal-Organic and Nano-Metal Chemistry, 2012 , vol. 42, # 8 p. 1071 - 1077 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,5-dinitro-benzoic acid,sodium salt |
| 3,5-Dinitro-benzoesaeure,Natrium-Verbindung |
| 3.5-Dinitro-benzoesaeure-Na-Salz |
| sodium 3,5-dinitrobenzoate |
| 3,5-Dinitro-benzoesaeure,Natriumsalz |
| sodium(OOCC6H3(NO2)2-3,5) |