Benzoic acid,3,5-dinitro-, 2-(phenylmethylene)hydrazide structure
|
Common Name | Benzoic acid,3,5-dinitro-, 2-(phenylmethylene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 39575-23-0 | Molecular Weight | 314.25300 | |
| Density | 1.43g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H10N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzal-3.5-dinitro-benzhydrazid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Molecular Formula | C14H10N4O5 |
| Molecular Weight | 314.25300 |
| Exact Mass | 314.06500 |
| PSA | 133.10000 |
| LogP | 3.70420 |
| Index of Refraction | 1.656 |
| InChIKey | VIQQTDMDKNJWHO-OQLLNIDSSA-N |
| SMILES | O=C(NN=Cc1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~76%
Benzoic acid,3,... CAS#:39575-23-0 |
| Literature: Kumar, Davinder; Judge, Vikramjeet; Narang, Rakesh; Sangwan, Sonia; De Clercq, Erik; Balzarini, Jan; Narasimhan, Balasubramanian European Journal of Medicinal Chemistry, 2010 , vol. 45, # 7 p. 2806 - 2816 |
|
~%
Benzoic acid,3,... CAS#:39575-23-0 |
| Literature: Curtius; Riedel Journal fuer Praktische Chemie (Leipzig), 1907 , vol. <2> 76, p. 255 |
|
~%
Benzoic acid,3,... CAS#:39575-23-0 |
| Literature: Sah; Ma Journal of the Chinese Chemical Society (Peking), 1934 , vol. 2, p. 40,43 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,5-Dinitro-benzoesaeure-benzylidenhydrazid |
| Benzaldehyd-(3.5-dinitro-benzoylhydrazon) |
| 3,5-dinitro-benzoic acid benzylidenehydrazide |