2,3,6-TRICHLOROPHENOL ACETATE
Modify Date: 2025-08-22 13:12:56
2,3,6-TRICHLOROPHENOL ACETATE structure
|
Common Name | 2,3,6-TRICHLOROPHENOL ACETATE | ||
|---|---|---|---|---|
| CAS Number | 61925-87-9 | Molecular Weight | 239.48300 | |
| Density | 1.469g/cm3 | Boiling Point | 306.2ºC at 760 mmHg | |
| Molecular Formula | C8H5Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.8ºC | |
| Name | (2,3,6-trichlorophenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 306.2ºC at 760 mmHg |
| Molecular Formula | C8H5Cl3O2 |
| Molecular Weight | 239.48300 |
| Flash Point | 131.8ºC |
| Exact Mass | 237.93600 |
| PSA | 26.30000 |
| LogP | 3.57210 |
| Index of Refraction | 1.554 |
| InChIKey | NIXCFOKFBOFURO-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c(Cl)ccc(Cl)c1Cl |
| HS Code | 2915390090 |
|---|
|
~%
2,3,6-TRICHLORO... CAS#:61925-87-9 |
| Literature: Lampert Journal fuer Praktische Chemie (Leipzig), 1886 , vol. <2> 33, p. 381 |
|
~%
2,3,6-TRICHLORO... CAS#:61925-87-9 |
| Literature: Lampert Journal fuer Praktische Chemie (Leipzig), 1886 , vol. <2> 33, p. 381 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2,3,6-Trichlorophenyl acetate |
| 2,3,6-Trichlorophenol acetate |
| (2.3.6-Trichlor-phenyl)-acetat |
| Essigsaeure-(2,3,6-trichlor-phenylester) |
| acetic acid-(2,3,6-trichloro-phenyl ester) |
| Phenol,2,3,6-trichloro-,acetate |