4-nitro-7,9-bis(trichloromethyl)-8,10-dioxabicyclo[4.4.0]deca-2,4,11-triene structure
|
Common Name | 4-nitro-7,9-bis(trichloromethyl)-8,10-dioxabicyclo[4.4.0]deca-2,4,11-triene | ||
|---|---|---|---|---|
| CAS Number | 61719-86-6 | Molecular Weight | 415.86900 | |
| Density | 1.792g/cm3 | Boiling Point | 468.4ºC at 760 mmHg | |
| Molecular Formula | C10H5Cl6NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.1ºC | |
| Name | 6-nitro-2,4-bis(trichloromethyl)-4H-1,3-benzodioxine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.792g/cm3 |
|---|---|
| Boiling Point | 468.4ºC at 760 mmHg |
| Molecular Formula | C10H5Cl6NO4 |
| Molecular Weight | 415.86900 |
| Flash Point | 237.1ºC |
| Exact Mass | 412.83500 |
| PSA | 64.28000 |
| LogP | 5.63460 |
| Index of Refraction | 1.617 |
| InChIKey | RCTXAWWKLZRCFU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(C(Cl)(Cl)Cl)OC(C(Cl)(Cl)Cl)O2 |
| HS Code | 2932999099 |
|---|
|
~80%
4-nitro-7,9-bis... CAS#:61719-86-6 |
| Literature: Hashimoto, Masao; Nakamura, Yasushige; Adachi, Masahiro; Hamada, Kensaku; Mano, Koichi Berichte der Bunsen-Gesellschaft, 1989 , vol. 93, p. 439 - 450 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-nitro-2,4-bis-trichloromethyl-4H-benzo[1,3]dioxin |
| 6-nitro-2,4-bis(trichloromethyl)-1,3-benzdioxin |
| 6-nitro-2,4-bis(trichloromethyl)-benzo-1,3-dioxine |
| 6-Nitro-2,4-bis-trichlormethyl-4H-benzo[1,3]dioxin |