4-(dichloromethylidene)-6-nitro-2-(trichloromethyl)-1,3-benzodioxine structure
|
Common Name | 4-(dichloromethylidene)-6-nitro-2-(trichloromethyl)-1,3-benzodioxine | ||
|---|---|---|---|---|
| CAS Number | 61720-18-1 | Molecular Weight | 379.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4Cl5NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(dichloromethylidene)-6-nitro-2-(trichloromethyl)-1,3-benzodioxine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H4Cl5NO4 |
|---|---|
| Molecular Weight | 379.40800 |
| Exact Mass | 376.85800 |
| PSA | 64.28000 |
| LogP | 5.32700 |
| InChIKey | JBMFMIXAZCTFGE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(=C(Cl)Cl)OC(C(Cl)(Cl)Cl)O2 |
|
~%
4-(dichlorometh... CAS#:61720-18-1 |
| Literature: Chattaway; Irving Journal of the Chemical Society, 1934 , p. 325,329 |
| 4-Dichlormethylen-6-nitro-2-trichlormethyl-4H-benzo[1,3]dioxin |
| 6-nitro-2-trichloromethyl-4-dichloromethylene-1,3-benzdioxin |
| 4-dichloromethylene-6-nitro-2-trichloromethyl-4H-benzo[1,3]dioxin |
| 4-dichloromethylene-6-nitro-2-trichloromethylbenzo[1,3]dioxin |
| 4H-1,3-Benzodioxin,4-(dichloromethylene)-6-nitro-2-(trichloromethyl) |