1-acetyl-2,4,5,7-tetramethoxyanthracene-9,10-dione structure
|
Common Name | 1-acetyl-2,4,5,7-tetramethoxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 61539-70-6 | Molecular Weight | 370.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-acetyl-2,4,5,7-tetramethoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H18O7 |
|---|---|
| Molecular Weight | 370.35300 |
| Exact Mass | 370.10500 |
| PSA | 88.13000 |
| LogP | 2.69900 |
| InChIKey | BNFOBJRMYJMGGA-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(c1)C(=O)c1c(C(C)=O)c(OC)cc(OC)c1C2=O |
|
~%
1-acetyl-2,4,5,... CAS#:61539-70-6 |
| Literature: Banville,J.; Brassard,P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1852 - 1856 |
|
~%
1-acetyl-2,4,5,... CAS#:61539-70-6 |
| Literature: Rideout, John A.; Sutherland, Maurice D. Australian Journal of Chemistry, 1985 , vol. 38, # 5 p. 793 - 808 |
| 9,10-Anthracenedione,1-acetyl-2,4,5,7-tetramethoxy |
| Tetra-O-methylrhodolamprometrin |