1-ethyl-2,4,5,7-tetramethoxyanthracene-9,10-dione
Modify Date: 2025-09-25 17:59:20
1-ethyl-2,4,5,7-tetramethoxyanthracene-9,10-dione structure
|
Common Name | 1-ethyl-2,4,5,7-tetramethoxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 61539-65-9 | Molecular Weight | 356.36900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethyl-2,4,5,7-tetramethoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H20O6 |
|---|---|
| Molecular Weight | 356.36900 |
| Exact Mass | 356.12600 |
| PSA | 71.06000 |
| LogP | 3.05880 |
| InChIKey | UBSOLGXBXNMBNI-UHFFFAOYSA-N |
| SMILES | CCc1c(OC)cc(OC)c2c1C(=O)c1cc(OC)cc(OC)c1C2=O |
|
~%
1-ethyl-2,4,5,7... CAS#:61539-65-9 |
| Literature: Banville,J.; Brassard,P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1852 - 1856 |
| 9,10-Anthracenedione,1-ethyl-2,4,5,7-tetramethoxy |
| 1-Ethyl-2,4,5,7-tetramethoxyanthraquinon |