1-butyl-2,4,5,7-tetramethoxyanthracene-9,10-dione structure
|
Common Name | 1-butyl-2,4,5,7-tetramethoxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 61539-66-0 | Molecular Weight | 384.42200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-butyl-2,4,5,7-tetramethoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H24O6 |
|---|---|
| Molecular Weight | 384.42200 |
| Exact Mass | 384.15700 |
| PSA | 71.06000 |
| LogP | 3.83900 |
| InChIKey | PUDPORLJNSJFOU-UHFFFAOYSA-N |
| SMILES | CCCCc1c(OC)cc(OC)c2c1C(=O)c1cc(OC)cc(OC)c1C2=O |
|
~%
1-butyl-2,4,5,7... CAS#:61539-66-0 |
| Literature: Banville,J.; Brassard,P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1852 - 1856 |
| 9,10-Anthracenedione,1-butyl-2,4,5,7-tetramethoxy |
| 1-Butyl-2,4,5,7-tetramethoxyanthraquinon |