12-DIMYRISTOYL-RAC-GLYCEROL(C14:0)
Modify Date: 2025-09-11 16:16:07
12-DIMYRISTOYL-RAC-GLYCEROL(C14:0) structure
|
Common Name | 12-DIMYRISTOYL-RAC-GLYCEROL(C14:0) | ||
|---|---|---|---|---|
| CAS Number | 61487-06-7 | Molecular Weight | 252.26800 | |
| Density | 1.31g/cm3 | Boiling Point | 475.841ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O2 | Melting Point | 275-279ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 241.58ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(6-oxocyclohexa-2,4-dien-1-ylidene)-1,5-dihydro-1,5-benzodiazepin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 475.841ºC at 760 mmHg |
| Melting Point | 275-279ºC(lit.) |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.26800 |
| Flash Point | 241.58ºC |
| Exact Mass | 252.09000 |
| PSA | 65.18000 |
| LogP | 2.37590 |
| Index of Refraction | 1.669 |
| InChIKey | HUFCCRRBLQYUTK-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2O)=Nc2ccccc2N1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~69%
12-DIMYRISTOYL-... CAS#:61487-06-7 |
| Literature: Kolos; Gozalishvili; Yaremenko; Shishkin; Shishkina; Konovalova Russian Chemical Bulletin, 2007 , vol. 56, # 11 p. 2277 - 2283 |
|
~82%
12-DIMYRISTOYL-... CAS#:61487-06-7 |
| Literature: Hamdi; Grech; Sakellariou; Speziale Journal of Heterocyclic Chemistry, 1994 , vol. 31, # 2 p. 509 - 511 |
CAS#:983-79-9| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(2'-hydroxyphenyl-1,5-benzodiazepin-2-one) |
| 1 3-DIHYDRO-4-(2-HYDROXYPHENYL)-2H-1 5-&4-(2-hydroxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepin-2-one |
| 1,3-Dihydro-4-(2-hydroxyphenyl)-2H-1,5-benzodiazepin-2-one |
| 4-(2-hydroxyphenyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
| 4-(2-hydroxy-phenyl)-1,3-dihydro-benzo[b][1,4]diazepin-2-one |
| 4-(2-hydroxyphenyl)-1H-benzo[b][1,4]diazepine-2(3H)-one |
| MFCD01961197 |