Closantel Sodium structure
|
Common Name | Closantel Sodium | ||
|---|---|---|---|---|
| CAS Number | 61438-64-0 | Molecular Weight | 685.06 | |
| Density | N/A | Boiling Point | 590.5ºC at 760 mmHg | |
| Molecular Formula | C22H13Cl2I2N2NaO2 | Melting Point | >230ºC (dec.) | |
| MSDS | N/A | Flash Point | 310.9ºC | |
Use of Closantel SodiumClosantel is a salicylanilide anthelmintic compound; exhibits different anthelmintic spectra and apparent toxicity in mammals. |
| Name | Closantel sodium |
|---|---|
| Synonym | More Synonyms |
| Description | Closantel is a salicylanilide anthelmintic compound; exhibits different anthelmintic spectra and apparent toxicity in mammals. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 590.5ºC at 760 mmHg |
|---|---|
| Melting Point | >230ºC (dec.) |
| Molecular Formula | C22H13Cl2I2N2NaO2 |
| Molecular Weight | 685.06 |
| Flash Point | 310.9ºC |
| PSA | 113.25000 |
| LogP | 4.51228 |
| InChIKey | OSRFZYBZFCOAGP-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)c1cc(I)cc(I)c1O.[Na] |
| Storage condition | Refrigerator |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2926909090 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 262-794-7 |
| MFCD03427328 |
| Sodium 2-({5-chloro-4-[(4-chlorophenyl)(cyano)methyl]-2-methylphenyl}carbamoyl)-1-hydroxy-4,6-diiodo-2,4-cyclohexadiene-1-carboxylate |
| 2,4-Cyclohexadiene-1-carboxylic acid, 2-[[[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]amino]carbonyl]-1-hydroxy-4,6-diiodo-, sodium salt (1:1) |
| Closantel (sodium) |