Glycerol phenylbutyrate
Modify Date: 2025-08-25 13:57:27
Glycerol phenylbutyrate structure
|
Common Name | Glycerol phenylbutyrate | ||
|---|---|---|---|---|
| CAS Number | 611168-24-2 | Molecular Weight | 530.65100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H38O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glycerol phenylbutyrateGlycerol phenylbutyrate is a sigma-2 (σ2) receptor ligand, with a pKi of 8.02. |
| Name | 2,3-bis(4-phenylbutanoyloxy)propyl 4-phenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Glycerol phenylbutyrate is a sigma-2 (σ2) receptor ligand, with a pKi of 8.02. |
|---|---|
| Related Catalog | |
| Target |
σ2 receptor[1]. |
| References |
| Molecular Formula | C33H38O6 |
|---|---|
| Molecular Weight | 530.65100 |
| Exact Mass | 530.26700 |
| PSA | 78.90000 |
| LogP | 6.05330 |
| InChIKey | ZSDBFLMJVAGKOU-UHFFFAOYSA-N |
| SMILES | O=C(CCCc1ccccc1)OCC(COC(=O)CCCc1ccccc1)OC(=O)CCCc1ccccc1 |
| Storage condition | 2-8℃ |
|
~2%
Detail
|
| Literature: Lunamed AG; Truog, Peter; Buschmann, Helmut H. Patent: EP2607366 A1, 2013 ; Location in patent: Paragraph 0058 ; |
| glycerol phenylbutyrate |
| glycerol PBA |
| glyceryl tri-(4-phenylbutyrate) |
| HPN-100 |
| Glycerol phenylbutyrate (USAN) |
| UNII-ZH6F1VCV7B |
| ZH6F1VCV7B |
| Ravicti |
| Ravicti (TN) |