Boc-His(3-Me)-OH
Modify Date: 2025-08-25 00:13:46
Boc-His(3-Me)-OH structure
|
Common Name | Boc-His(3-Me)-OH | ||
|---|---|---|---|---|
| CAS Number | 61070-22-2 | Molecular Weight | 269.29700 | |
| Density | 1.23 | Boiling Point | 502.2ºC at 760 mmHg | |
| Molecular Formula | C12H19N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.5ºC | |
| Name | (2S)-3-(3-methylimidazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23 |
|---|---|
| Boiling Point | 502.2ºC at 760 mmHg |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.29700 |
| Flash Point | 257.5ºC |
| Exact Mass | 269.13800 |
| PSA | 93.45000 |
| LogP | 1.33140 |
| Index of Refraction | 1.547 |
| InChIKey | BGZFLUIZBZNCTI-VIFPVBQESA-N |
| SMILES | Cn1cncc1CC(NC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | -15°C |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2S)-2-[(tert-Butoxycarbonyl)amino]-3-(1-methyl-1H-imidazol-5-yl)propionicacid |
| N-[(tert-Butoxy)carbonyl]-3-methyl-L-histidine |
| Boc-His(Nτ-Me)-OH |