(Des-Gly10,tBu-D-Gly6,Pro-NHEt9)-LHRH trifluoroacetate salt
Modify Date: 2025-08-20 18:04:24
(Des-Gly10,tBu-D-Gly6,Pro-NHEt9)-LHRH trifluoroacetate salt structure
|
Common Name | (Des-Gly10,tBu-D-Gly6,Pro-NHEt9)-LHRH trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 61012-19-9 | Molecular Weight | 1209.398 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C59H84N16O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (Des-Gly10,tBu-D-Gly6,Pro-NHEt9)-LHRH trifluoroacetate saltLecirelin is a synthetic gonadotropin-releasing hormone (GnRH) analogue. Lecirelin is widely used for the research of bovine ovarian follicular cysts[1]. |
| Name | lecirelin |
|---|---|
| Synonym | More Synonyms |
| Description | Lecirelin is a synthetic gonadotropin-releasing hormone (GnRH) analogue. Lecirelin is widely used for the research of bovine ovarian follicular cysts[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Lecirelin (2.07 μM) significantly increases the tension and frequency of contractions in preovulatory follicles (PF), small follicular cysts (FC-S), and large follicular cysts (FC-L)[1]. Lecirelin increases the strips from preovulatory follicles contract significantly more than strips from cysts[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C59H84N16O12 |
| Molecular Weight | 1209.398 |
| Exact Mass | 1208.645508 |
| PSA | 429.04000 |
| LogP | 0.23 |
| Index of Refraction | 1.678 |
| InChIKey | XJWIEWPGHRSZJM-MGZASHDBSA-N |
| SMILES | CCNC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1cnc[nH]1)NC(=O)C1CCC(=O)N1)C(C)(C)C |
| Storage condition | -20°C |
| Lecirelin (Dalmarelin) Acetate |
| 5-Oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-3-methyl-D-valyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide |
| L-Prolinamide, 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-3-methyl-D-valyl-L-leucyl-L-arginyl-N-ethyl- |
| Lecirelin Acetate |
| Supergestran |
| GLP-HIS-TRP-SER-TYR-TLE-LEU-ARG-PRO-NHET |