1-(3,6-Diiodo-9H-carbazol-9-yl)ethanone structure
|
Common Name | 1-(3,6-Diiodo-9H-carbazol-9-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 606129-89-9 | Molecular Weight | 461.036 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | 453.8±38.0 °C at 760 mmHg | |
| Molecular Formula | C14H9I2NO | Melting Point | 228ºC | |
| MSDS | N/A | Flash Point | 228.3±26.8 °C | |
| Name | 9-Acetyl-3,6-diiodocarbazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 453.8±38.0 °C at 760 mmHg |
| Melting Point | 228ºC |
| Molecular Formula | C14H9I2NO |
| Molecular Weight | 461.036 |
| Flash Point | 228.3±26.8 °C |
| Exact Mass | 460.877319 |
| PSA | 22.00000 |
| LogP | 5.69 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.771 |
| InChIKey | HAZMJWKYEJRBCO-UHFFFAOYSA-N |
| SMILES | CC(=O)n1c2ccc(I)cc2c2cc(I)ccc21 |
| HS Code | 2933990090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(3,6-Diiodo-9H-carbazol-9-yl)ethanone |
| Ethanone, 1-(3,6-diiodo-9H-carbazol-9-yl)- |
| 1-(3,6-diiodocarbazol-9-yl)ethanone |