ibotenic acid monohydrate structure
|
Common Name | ibotenic acid monohydrate | ||
|---|---|---|---|---|
| CAS Number | 60573-88-8 | Molecular Weight | 176.12700 | |
| Density | 1.621g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H8N2O5 | Melting Point | 148-151ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (‘±)-Ibotenic acid monohydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.621g/cm3 |
|---|---|
| Melting Point | 148-151ºC |
| Molecular Formula | C5H8N2O5 |
| Molecular Weight | 176.12700 |
| Exact Mass | 176.04300 |
| PSA | 118.55000 |
| Appearance of Characters | Powder or Solid | White to off-white to light yellow |
| Index of Refraction | 1.588 |
| InChIKey | QVKQQLYSTODTJN-UHFFFAOYSA-N |
| SMILES | NC(C(=O)O)c1cc(=O)[nH]o1.O |
| Storage condition | Freezer (-20°C) |
| Water Solubility | NH4OH 1 M: 50 mg/mL, clear, colorless to yellow |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | T |
|---|---|
| Risk Phrases | 25 |
| Safety Phrases | 22-36/37/39-45 |
| RIDADR | UN 3462 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NY2100000 |
| HS Code | 2934999090 |
|
~%
ibotenic acid m... CAS#:60573-88-8 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 359 - 364 |
|
~%
ibotenic acid m... CAS#:60573-88-8 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 359 - 364 |
|
~%
ibotenic acid m... CAS#:60573-88-8 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 359 - 364 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 218-853-4 |
| 2-amino-2-(3-oxo-1,2-oxazol-5-yl)acetic acid,hydrate |
| MFCD00150903 |