1,10-Decanediol, bisulfamate (ester) structure
|
Common Name | 1,10-Decanediol, bisulfamate (ester) | ||
|---|---|---|---|---|
| CAS Number | 60548-61-0 | Molecular Weight | 332.43700 | |
| Density | 1.299g/cm3 | Boiling Point | 490.3ºC at 760 mmHg | |
| Molecular Formula | C10H24N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.3ºC | |
| Name | 10-sulfamoyloxydecyl sulfamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 490.3ºC at 760 mmHg |
| Molecular Formula | C10H24N2O6S2 |
| Molecular Weight | 332.43700 |
| Flash Point | 250.3ºC |
| Exact Mass | 332.10800 |
| PSA | 155.54000 |
| LogP | 4.10960 |
| Index of Refraction | 1.511 |
| InChIKey | XPDWKENHTJHZSC-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)OCCCCCCCCCCOS(N)(=O)=O |
|
~%
1,10-Decanediol... CAS#:60548-61-0 |
| Literature: Hirsch, Allen F.; Kasulanis, Charles; Kraft, Larry; Mallory, Robert A.; Powell, Gregory; Wong, Benny Journal of Medicinal Chemistry, 1981 , vol. 24, # 7 p. 901 - 903 |
| bis-sulfamate,4 |
| 3ibn |
| Sulfamic acid,decamethylene ester |
| 1,10-Decanediol,bisulfamate (ester) |
| Decane-1,10-Diyl Disulfamate |