1,1,1,3,10,11-Hexachloroundecane
Modify Date: 2025-08-24 19:03:18
1,1,1,3,10,11-Hexachloroundecane structure
|
Common Name | 1,1,1,3,10,11-Hexachloroundecane | ||
|---|---|---|---|---|
| CAS Number | 601523-28-8 | Molecular Weight | 362.979 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 384.5±10.0 °C at 760 mmHg | |
| Molecular Formula | C11H18Cl6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1±16.4 °C | |
Use of 1,1,1,3,10,11-Hexachloroundecane1,1,1,3,10,11-Hexachloroundecane is a kind of polychlorinated alkane (PCA) that has a long carbon chain length[1]. |
| Name | 1,1,1,3,10,11-hexachloroundecane |
|---|---|
| Synonym | More Synonyms |
| Description | 1,1,1,3,10,11-Hexachloroundecane is a kind of polychlorinated alkane (PCA) that has a long carbon chain length[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 384.5±10.0 °C at 760 mmHg |
| Molecular Formula | C11H18Cl6 |
| Molecular Weight | 362.979 |
| Flash Point | 176.1±16.4 °C |
| Exact Mass | 359.953979 |
| LogP | 6.66 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | BGUCVTBWQJKWCX-UHFFFAOYSA-N |
| SMILES | ClCC(Cl)CCCCCCC(Cl)CC(Cl)(Cl)Cl |
| Storage condition | 2-8°C |
| Hazard Codes | N |
|---|
| Undecane, 1,1,1,3,10,11-hexachloro- |
| 1,1,1,3,10,11-Hexachloroundecane |