methyl 3-chloro-6-methylbenzo(b)thiophe&
Modify Date: 2025-08-21 20:49:52
methyl 3-chloro-6-methylbenzo(b)thiophe& structure
|
Common Name | methyl 3-chloro-6-methylbenzo(b)thiophe& | ||
|---|---|---|---|---|
| CAS Number | 59812-34-9 | Molecular Weight | 240.70600 | |
| Density | 1.343g/cm3 | Boiling Point | 355.1ºC at 760 mmHg | |
| Molecular Formula | C11H9ClO2S | Melting Point | 88-92ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 168.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Methyl 3-chloro-6-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 355.1ºC at 760 mmHg |
| Melting Point | 88-92ºC(lit.) |
| Molecular Formula | C11H9ClO2S |
| Molecular Weight | 240.70600 |
| Flash Point | 168.6ºC |
| Exact Mass | 240.00100 |
| PSA | 54.54000 |
| LogP | 3.64970 |
| Index of Refraction | 1.632 |
| InChIKey | MGACFENQJJMRFI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sc2cc(C)ccc2c1Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319-H413 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
|
~%
methyl 3-chloro... CAS#:59812-34-9 |
| Literature: WO2007/16784 A1, ; Page/Page column 32; 42 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 3-chloro-6-methylbenzo[b]thiophen-2-carboxylate |
| MFCD01630702 |
| 3-chloro-2-methoxycarbonyl-6-methylbenzo[b]thiophene |
| methyl 6-Methyl-3-Chlorobenzo[b]thiophene-2-Carboxylate |
| Methyl 3-chloro-6-methylbenzo[b]thiophene-2-carboxylate |
| 3-chloro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester |