3-chloro-6-methylbenzo(b)thiophene-2-ca& structure
|
Common Name | 3-chloro-6-methylbenzo(b)thiophene-2-ca& | ||
|---|---|---|---|---|
| CAS Number | 34576-96-0 | Molecular Weight | 226.679 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 405.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H7ClO2S | Melting Point | 271-275ºC(lit.) | |
| MSDS | USA | Flash Point | 199.0±27.3 °C | |
| Name | 3-chloro-6-methyl-1-benzothiophene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 405.5±40.0 °C at 760 mmHg |
| Melting Point | 271-275ºC(lit.) |
| Molecular Formula | C10H7ClO2S |
| Molecular Weight | 226.679 |
| Flash Point | 199.0±27.3 °C |
| Exact Mass | 225.985519 |
| PSA | 65.54000 |
| LogP | 4.59 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | KWGVHWHFCFSQAZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(Cl)c(C(=O)O)sc2c1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Chlor-6-methylbenzo<b>thiophen-2-carbonsaeure |
| 3-Chloro-6-methyl-1-benzothiophene-2-carboxylic acid |
| MFCD00687576 |
| 3-Chloro-6-methylbenzo[b]thiophene-2-carboxylic acid |
| T56 BSJ CVQ DG H1 |
| Benzo[b]thiophene-2-carboxylic acid, 3-chloro-6-methyl- |